C22H21FN2O7S — CID 91354517
carbamoyl 5-(cyclopropylmethoxy)-2-(4-fluorophenyl)-6-[methyl(methylsulfonyl)amino]-1-benzofuran-3-carboxylate (PubChem CID 91354517) has the molecular formula C22H21FN2O7S and a molecular weight of 476.48 g/mol. Its IUPAC name is carbamoyl 5-(cyclopropylmethoxy)-2-(4-fluorophenyl)-6-[methyl(methylsulfonyl)amino]-1-benzofuran-3-carboxylate.
| Compound Name | carbamoyl 5-(cyclopropylmethoxy)-2-(4-fluorophenyl)-6-[methyl(methylsulfonyl)amino]-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 91354517 |
| Molecular Formula | C22H21FN2O7S |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | carbamoyl 5-(cyclopropylmethoxy)-2-(4-fluorophenyl)-6-[methyl(methylsulfonyl)amino]-1-benzofuran-3-carboxylate |
| SMILES | CN(c1cc2oc(-c3ccc(F)cc3)c(C(=O)OC(N)=O)c2cc1OCC1CC1)S(C)(=O)=O |
| InChI | InChI=1S/C22H21FN2O7S/c1-25(33(2,28)29)16-10-17-15(9-18(16)30-11-12-3-4-12)19(21(26)32-22(24)27)20(31-17)13-5-7-14(23)8-6-13/h5-10,12H,3-4,11H2,1-2H3,(H2,24,27) |
| InChIKey | BESXQRCNJPFZFI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 129.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|