C19H17FN2O7S — CID 91295499
carbamoyl 2-(4-fluorophenyl)-6-[2-hydroxyethyl(methylsulfonyl)amino]-1-benzofuran-3-carboxylate (PubChem CID 91295499) has the molecular formula C19H17FN2O7S and a molecular weight of 436.42 g/mol. Its IUPAC name is carbamoyl 2-(4-fluorophenyl)-6-[2-hydroxyethyl(methylsulfonyl)amino]-1-benzofuran-3-carboxylate.
| Compound Name | carbamoyl 2-(4-fluorophenyl)-6-[2-hydroxyethyl(methylsulfonyl)amino]-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 91295499 |
| Molecular Formula | C19H17FN2O7S |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | carbamoyl 2-(4-fluorophenyl)-6-[2-hydroxyethyl(methylsulfonyl)amino]-1-benzofuran-3-carboxylate |
| SMILES | CS(=O)(=O)N(CCO)c1ccc2c(C(=O)OC(N)=O)c(-c3ccc(F)cc3)oc2c1 |
| InChI | InChI=1S/C19H17FN2O7S/c1-30(26,27)22(8-9-23)13-6-7-14-15(10-13)28-17(11-2-4-12(20)5-3-11)16(14)18(24)29-19(21)25/h2-7,10,23H,8-9H2,1H3,(H2,21,25) |
| InChIKey | DVQLEYNUIBAJEP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|