C20H20FN3O8S2 — CID 123736495
carbamoyl 2-(4-fluorophenyl)-6-[methylsulfonyl(3-methylsulfonylpropyl)amino]furo[2,3-b]pyridine-3-carboxylate (PubChem CID 123736495) has the molecular formula C20H20FN3O8S2 and a molecular weight of 513.53 g/mol. Its IUPAC name is carbamoyl 2-(4-fluorophenyl)-6-[methylsulfonyl(3-methylsulfonylpropyl)amino]furo[2,3-b]pyridine-3-carboxylate.
| Compound Name | carbamoyl 2-(4-fluorophenyl)-6-[methylsulfonyl(3-methylsulfonylpropyl)amino]furo[2,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 123736495 |
| Molecular Formula | C20H20FN3O8S2 |
| Molecular Weight | 513.53 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | carbamoyl 2-(4-fluorophenyl)-6-[methylsulfonyl(3-methylsulfonylpropyl)amino]furo[2,3-b]pyridine-3-carboxylate |
| SMILES | CS(=O)(=O)CCCN(c1ccc2c(C(=O)OC(N)=O)c(-c3ccc(F)cc3)oc2n1)S(C)(=O)=O |
| InChI | InChI=1S/C20H20FN3O8S2/c1-33(27,28)11-3-10-24(34(2,29)30)15-9-8-14-16(19(25)32-20(22)26)17(31-18(14)23-15)12-4-6-13(21)7-5-12/h4-9H,3,10-11H2,1-2H3,(H2,22,26) |
| InChIKey | IVUUUEQYEWCFCT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.53 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|