C29H32FN3O6S — CID 58052351
5-ethyl-2-(4-fluorophenyl)-6-[4-(2-methoxyphenoxy)butyl-methylsulfonylamino]-N-methylfuro[2,3-b]pyridine-3-carboxamide (PubChem CID 58052351) has the molecular formula C29H32FN3O6S and a molecular weight of 569.66 g/mol. Its IUPAC name is 5-ethyl-2-(4-fluorophenyl)-6-[4-(2-methoxyphenoxy)butyl-methylsulfonylamino]-N-methylfuro[2,3-b]pyridine-3-carboxamide.
| Compound Name | 5-ethyl-2-(4-fluorophenyl)-6-[4-(2-methoxyphenoxy)butyl-methylsulfonylamino]-N-methylfuro[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58052351 |
| Molecular Formula | C29H32FN3O6S |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | 5-ethyl-2-(4-fluorophenyl)-6-[4-(2-methoxyphenoxy)butyl-methylsulfonylamino]-N-methylfuro[2,3-b]pyridine-3-carboxamide |
| SMILES | CCc1cc2c(C(=O)NC)c(-c3ccc(F)cc3)oc2nc1N(CCCCOc1ccccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C29H32FN3O6S/c1-5-19-18-22-25(28(34)31-2)26(20-12-14-21(30)15-13-20)39-29(22)32-27(19)33(40(4,35)36)16-8-9-17-38-24-11-7-6-10-23(24)37-3/h6-7,10-15,18H,5,8-9,16-17H2,1-4H3,(H,31,34) |
| InChIKey | UXCCYLFCEPXHAA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|