C25H33IN3O6PS — CID 58052454
6-[4-[ethoxy(methyl)phosphoryl]butyl-methylsulfonylamino]-2-(4-ethylphenyl)-5-iodo-N-methylfuro[2,3-b]pyridine-3-carboxamide (PubChem CID 58052454) has the molecular formula C25H33IN3O6PS and a molecular weight of 661.50 g/mol. Its IUPAC name is 6-[4-[ethoxy(methyl)phosphoryl]butyl-methylsulfonylamino]-2-(4-ethylphenyl)-5-iodo-N-methylfuro[2,3-b]pyridine-3-carboxamide.
| Compound Name | 6-[4-[ethoxy(methyl)phosphoryl]butyl-methylsulfonylamino]-2-(4-ethylphenyl)-5-iodo-N-methylfuro[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58052454 |
| Molecular Formula | C25H33IN3O6PS |
| Molecular Weight | 661.50 g/mol |
| Exact Mass | 661.09 |
| IUPAC Name | 6-[4-[ethoxy(methyl)phosphoryl]butyl-methylsulfonylamino]-2-(4-ethylphenyl)-5-iodo-N-methylfuro[2,3-b]pyridine-3-carboxamide |
| SMILES | CCOP(C)(=O)CCCCN(c1nc2oc(-c3ccc(CC)cc3)c(C(=O)NC)c2cc1I)S(C)(=O)=O |
| InChI | InChI=1S/C25H33IN3O6PS/c1-6-17-10-12-18(13-11-17)22-21(24(30)27-3)19-16-20(26)23(28-25(19)35-22)29(37(5,32)33)14-8-9-15-36(4,31)34-7-2/h10-13,16H,6-9,14-15H2,1-5H3,(H,27,30) |
| InChIKey | BTSNXXVEUVVGRR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|