C19H20IN3O4S — CID 129202728
6-[ethyl(methylsulfonyl)amino]-5-iodo-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 129202728) has the molecular formula C19H20IN3O4S and a molecular weight of 513.36 g/mol. Its IUPAC name is 6-[ethyl(methylsulfonyl)amino]-5-iodo-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 6-[ethyl(methylsulfonyl)amino]-5-iodo-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 129202728 |
| Molecular Formula | C19H20IN3O4S |
| Molecular Weight | 513.36 g/mol |
| Exact Mass | 513.02 |
| IUPAC Name | 6-[ethyl(methylsulfonyl)amino]-5-iodo-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CCN(c1nc2oc(-c3ccc(C)cc3)c(C(=O)NC)c2cc1I)S(C)(=O)=O |
| InChI | InChI=1S/C19H20IN3O4S/c1-5-23(28(4,25)26)17-14(20)10-13-15(18(24)21-3)16(27-19(13)22-17)12-8-6-11(2)7-9-12/h6-10H,5H2,1-4H3,(H,21,24) |
| InChIKey | CYQVBVBRSVYYHL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|