C21H23ClIN3O6S2 — CID 122472600
2-(4-chlorophenyl)-5-iodo-3-(methylcarbamoyl)-6-[5-methylsulfonylpentyl(sulfino)amino]furo[2,3-b]pyridine (PubChem CID 122472600) has the molecular formula C21H23ClIN3O6S2 and a molecular weight of 639.92 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-iodo-3-(methylcarbamoyl)-6-[5-methylsulfonylpentyl(sulfino)amino]furo[2,3-b]pyridine.
| Compound Name | 2-(4-chlorophenyl)-5-iodo-3-(methylcarbamoyl)-6-[5-methylsulfonylpentyl(sulfino)amino]furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 122472600 |
| Molecular Formula | C21H23ClIN3O6S2 |
| Molecular Weight | 639.92 g/mol |
| Exact Mass | 638.98 |
| IUPAC Name | 2-(4-chlorophenyl)-5-iodo-3-(methylcarbamoyl)-6-[5-methylsulfonylpentyl(sulfino)amino]furo[2,3-b]pyridine |
| SMILES | CNC(=O)c1c(-c2ccc(Cl)cc2)oc2nc(N(CCCCCS(C)(=O)=O)S(=O)O)c(I)cc12 |
| InChI | InChI=1S/C21H23ClIN3O6S2/c1-24-20(27)17-15-12-16(23)19(26(33(28)29)10-4-3-5-11-34(2,30)31)25-21(15)32-18(17)13-6-8-14(22)9-7-13/h6-9,12H,3-5,10-11H2,1-2H3,(H,24,27)(H,28,29) |
| InChIKey | KVHDHKCDIVWNPL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.92 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|