C25H32N4O4S — CID 54575944
6-[5-aminopentyl(methylsulfonyl)amino]-5-cyclopropyl-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 54575944) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is 6-[5-aminopentyl(methylsulfonyl)amino]-5-cyclopropyl-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 6-[5-aminopentyl(methylsulfonyl)amino]-5-cyclopropyl-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 54575944 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 6-[5-aminopentyl(methylsulfonyl)amino]-5-cyclopropyl-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(C)cc2)oc2nc(N(CCCCCN)S(C)(=O)=O)c(C3CC3)cc12 |
| InChI | InChI=1S/C25H32N4O4S/c1-16-7-9-18(10-8-16)22-21(24(30)27-2)20-15-19(17-11-12-17)23(28-25(20)33-22)29(34(3,31)32)14-6-4-5-13-26/h7-10,15,17H,4-6,11-14,26H2,1-3H3,(H,27,30) |
| InChIKey | POLQTCLVKMDVDR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|