C25H31N3O6S2 — CID 66664414
5-cyclopropyl-N-methyl-2-(4-methylphenyl)-6-(5-methylsulfonylpentylsulfonylamino)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 66664414) has the molecular formula C25H31N3O6S2 and a molecular weight of 533.67 g/mol. Its IUPAC name is 5-cyclopropyl-N-methyl-2-(4-methylphenyl)-6-(5-methylsulfonylpentylsulfonylamino)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-methyl-2-(4-methylphenyl)-6-(5-methylsulfonylpentylsulfonylamino)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66664414 |
| Molecular Formula | C25H31N3O6S2 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 5-cyclopropyl-N-methyl-2-(4-methylphenyl)-6-(5-methylsulfonylpentylsulfonylamino)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(C)cc2)oc2nc(NS(=O)(=O)CCCCCS(C)(=O)=O)c(C3CC3)cc12 |
| InChI | InChI=1S/C25H31N3O6S2/c1-16-7-9-18(10-8-16)22-21(24(29)26-2)20-15-19(17-11-12-17)23(27-25(20)34-22)28-36(32,33)14-6-4-5-13-35(3,30)31/h7-10,15,17H,4-6,11-14H2,1-3H3,(H,26,29)(H,27,28) |
| InChIKey | LTOMVJOYXUWHRL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|