C29H39N3O4S — CID 122472652
5-cyclopropyl-N-methyl-2-(4-methylphenyl)-6-(nonylsulfamoylmethyl)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 122472652) has the molecular formula C29H39N3O4S and a molecular weight of 525.72 g/mol. Its IUPAC name is 5-cyclopropyl-N-methyl-2-(4-methylphenyl)-6-(nonylsulfamoylmethyl)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-methyl-2-(4-methylphenyl)-6-(nonylsulfamoylmethyl)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 122472652 |
| Molecular Formula | C29H39N3O4S |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | 5-cyclopropyl-N-methyl-2-(4-methylphenyl)-6-(nonylsulfamoylmethyl)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CCCCCCCCCNS(=O)(=O)Cc1nc2oc(-c3ccc(C)cc3)c(C(=O)NC)c2cc1C1CC1 |
| InChI | InChI=1S/C29H39N3O4S/c1-4-5-6-7-8-9-10-17-31-37(34,35)19-25-23(21-15-16-21)18-24-26(28(33)30-3)27(36-29(24)32-25)22-13-11-20(2)12-14-22/h11-14,18,21,31H,4-10,15-17,19H2,1-3H3,(H,30,33) |
| InChIKey | TZZZMOAOCLHCCZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|