C24H31IN3O6PS — CID 66664428
6-[4-[ethoxy(methyl)phosphoryl]butylsulfamoylmethyl]-5-iodo-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 66664428) has the molecular formula C24H31IN3O6PS and a molecular weight of 647.47 g/mol. Its IUPAC name is 6-[4-[ethoxy(methyl)phosphoryl]butylsulfamoylmethyl]-5-iodo-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 6-[4-[ethoxy(methyl)phosphoryl]butylsulfamoylmethyl]-5-iodo-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66664428 |
| Molecular Formula | C24H31IN3O6PS |
| Molecular Weight | 647.47 g/mol |
| Exact Mass | 647.07 |
| IUPAC Name | 6-[4-[ethoxy(methyl)phosphoryl]butylsulfamoylmethyl]-5-iodo-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CCOP(C)(=O)CCCCNS(=O)(=O)Cc1nc2oc(-c3ccc(C)cc3)c(C(=O)NC)c2cc1I |
| InChI | InChI=1S/C24H31IN3O6PS/c1-5-33-35(4,30)13-7-6-12-27-36(31,32)15-20-19(25)14-18-21(23(29)26-3)22(34-24(18)28-20)17-10-8-16(2)9-11-17/h8-11,14,27H,5-7,12-13,15H2,1-4H3,(H,26,29) |
| InChIKey | LBZHGPUURWSHRM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|