C18H15IN2O4 — CID 66663635
methyl 6-acetamido-5-iodo-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxylate (PubChem CID 66663635) has the molecular formula C18H15IN2O4 and a molecular weight of 450.23 g/mol. Its IUPAC name is methyl 6-acetamido-5-iodo-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxylate.
| Compound Name | methyl 6-acetamido-5-iodo-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 66663635 |
| Molecular Formula | C18H15IN2O4 |
| Molecular Weight | 450.23 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | methyl 6-acetamido-5-iodo-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)oc2nc(NC(C)=O)c(I)cc12 |
| InChI | InChI=1S/C18H15IN2O4/c1-9-4-6-11(7-5-9)15-14(18(23)24-3)12-8-13(19)16(20-10(2)22)21-17(12)25-15/h4-8H,1-3H3,(H,20,21,22) |
| InChIKey | VLFMSOMTBKXVRF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.23 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|