C15H8BrCl2NO3 — CID 118576869
methyl 5-bromo-6-chloro-2-(4-chlorophenyl)furo[2,3-b]pyridine-3-carboxylate (PubChem CID 118576869) has the molecular formula C15H8BrCl2NO3 and a molecular weight of 401.04 g/mol. Its IUPAC name is methyl 5-bromo-6-chloro-2-(4-chlorophenyl)furo[2,3-b]pyridine-3-carboxylate.
| Compound Name | methyl 5-bromo-6-chloro-2-(4-chlorophenyl)furo[2,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 118576869 |
| Molecular Formula | C15H8BrCl2NO3 |
| Molecular Weight | 401.04 g/mol |
| Exact Mass | 398.91 |
| IUPAC Name | methyl 5-bromo-6-chloro-2-(4-chlorophenyl)furo[2,3-b]pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Cl)cc2)oc2nc(Cl)c(Br)cc12 |
| InChI | InChI=1S/C15H8BrCl2NO3/c1-21-15(20)11-9-6-10(16)13(18)19-14(9)22-12(11)7-2-4-8(17)5-3-7/h2-6H,1H3 |
| InChIKey | JDLJVFXBEJBOLC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.04 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|