C27H34IN3O7S — CID 66664141
ethyl 3-hydroxy-6-[[5-iodo-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridin-6-yl]methylsulfonylamino]-2,2-dimethylhexanoate (PubChem CID 66664141) has the molecular formula C27H34IN3O7S and a molecular weight of 671.55 g/mol. Its IUPAC name is ethyl 3-hydroxy-6-[[5-iodo-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridin-6-yl]methylsulfonylamino]-2,2-dimethylhexanoate.
| Compound Name | ethyl 3-hydroxy-6-[[5-iodo-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridin-6-yl]methylsulfonylamino]-2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 66664141 |
| Molecular Formula | C27H34IN3O7S |
| Molecular Weight | 671.55 g/mol |
| Exact Mass | 671.12 |
| IUPAC Name | ethyl 3-hydroxy-6-[[5-iodo-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridin-6-yl]methylsulfonylamino]-2,2-dimethylhexanoate |
| SMILES | CCOC(=O)C(C)(C)C(O)CCCNS(=O)(=O)Cc1nc2oc(-c3ccc(C)cc3)c(C(=O)NC)c2cc1I |
| InChI | InChI=1S/C27H34IN3O7S/c1-6-37-26(34)27(3,4)21(32)8-7-13-30-39(35,36)15-20-19(28)14-18-22(24(33)29-5)23(38-25(18)31-20)17-11-9-16(2)10-12-17/h9-12,14,21,30,32H,6-8,13,15H2,1-5H3,(H,29,33) |
| InChIKey | SFISOQABKBNSKS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 147.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|