C23H28IN3O4S — CID 71065838
2-(4-ethylphenyl)-5-iodo-N-methyl-6-(pentylsulfamoylmethyl)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 71065838) has the molecular formula C23H28IN3O4S and a molecular weight of 569.47 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-5-iodo-N-methyl-6-(pentylsulfamoylmethyl)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 2-(4-ethylphenyl)-5-iodo-N-methyl-6-(pentylsulfamoylmethyl)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71065838 |
| Molecular Formula | C23H28IN3O4S |
| Molecular Weight | 569.47 g/mol |
| Exact Mass | 569.08 |
| IUPAC Name | 2-(4-ethylphenyl)-5-iodo-N-methyl-6-(pentylsulfamoylmethyl)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CCCCCNS(=O)(=O)Cc1nc2oc(-c3ccc(CC)cc3)c(C(=O)NC)c2cc1I |
| InChI | InChI=1S/C23H28IN3O4S/c1-4-6-7-12-26-32(29,30)14-19-18(24)13-17-20(22(28)25-3)21(31-23(17)27-19)16-10-8-15(5-2)9-11-16/h8-11,13,26H,4-7,12,14H2,1-3H3,(H,25,28) |
| InChIKey | VFMNYYGCRNGDBG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|