C24H31IN3O6PS — CID 66663488
2-(4-ethylphenyl)-6-[[5-[hydroxy(methyl)phosphoryl]pentyl-sulfinoamino]methyl]-5-iodo-3-(methylcarbamoyl)furo[2,3-b]pyridine (PubChem CID 66663488) has the molecular formula C24H31IN3O6PS and a molecular weight of 647.47 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-6-[[5-[hydroxy(methyl)phosphoryl]pentyl-sulfinoamino]methyl]-5-iodo-3-(methylcarbamoyl)furo[2,3-b]pyridine.
| Compound Name | 2-(4-ethylphenyl)-6-[[5-[hydroxy(methyl)phosphoryl]pentyl-sulfinoamino]methyl]-5-iodo-3-(methylcarbamoyl)furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 66663488 |
| Molecular Formula | C24H31IN3O6PS |
| Molecular Weight | 647.47 g/mol |
| Exact Mass | 647.07 |
| IUPAC Name | 2-(4-ethylphenyl)-6-[[5-[hydroxy(methyl)phosphoryl]pentyl-sulfinoamino]methyl]-5-iodo-3-(methylcarbamoyl)furo[2,3-b]pyridine |
| SMILES | CCc1ccc(-c2oc3nc(CN(CCCCCP(C)(=O)O)S(=O)O)c(I)cc3c2C(=O)NC)cc1 |
| InChI | InChI=1S/C24H31IN3O6PS/c1-4-16-8-10-17(11-9-16)22-21(23(29)26-2)18-14-19(25)20(27-24(18)34-22)15-28(36(32)33)12-6-5-7-13-35(3,30)31/h8-11,14H,4-7,12-13,15H2,1-3H3,(H,26,29)(H,30,31)(H,32,33) |
| InChIKey | YHSHZLBHRDCLSB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 132.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|