C22H23FN3O6S- — CID 122472669
6-[[3-carboxypropyl(sulfinato)amino]methyl]-5-ethyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)furo[2,3-b]pyridine (PubChem CID 122472669) has the molecular formula C22H23FN3O6S- and a molecular weight of 476.51 g/mol. Its IUPAC name is 6-[[3-carboxypropyl(sulfinato)amino]methyl]-5-ethyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)furo[2,3-b]pyridine.
| Compound Name | 6-[[3-carboxypropyl(sulfinato)amino]methyl]-5-ethyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 122472669 |
| Molecular Formula | C22H23FN3O6S- |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 6-[[3-carboxypropyl(sulfinato)amino]methyl]-5-ethyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)furo[2,3-b]pyridine |
| SMILES | CCc1cc2c(C(=O)NC)c(-c3ccc(F)cc3)oc2nc1CN(CCCC(=O)O)S(=O)[O-] |
| InChI | InChI=1S/C22H24FN3O6S/c1-3-13-11-16-19(21(29)24-2)20(14-6-8-15(23)9-7-14)32-22(16)25-17(13)12-26(33(30)31)10-4-5-18(27)28/h6-9,11H,3-5,10,12H2,1-2H3,(H,24,29)(H,27,28)(H,30,31)/p-1 |
| InChIKey | XICLDNZNXTWOSP-UHFFFAOYSA-M |
| XLogP | 3.02 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|