C24H25FN3O6S- — CID 66663905
6-[[4-carboxybutyl(sulfinato)amino]methyl]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)furo[2,3-b]pyridine (PubChem CID 66663905) has the molecular formula C24H25FN3O6S- and a molecular weight of 502.54 g/mol. Its IUPAC name is 6-[[4-carboxybutyl(sulfinato)amino]methyl]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)furo[2,3-b]pyridine.
| Compound Name | 6-[[4-carboxybutyl(sulfinato)amino]methyl]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 66663905 |
| Molecular Formula | C24H25FN3O6S- |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 6-[[4-carboxybutyl(sulfinato)amino]methyl]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)furo[2,3-b]pyridine |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2nc(CN(CCCCC(=O)O)S(=O)[O-])c(C3CC3)cc12 |
| InChI | InChI=1S/C24H26FN3O6S/c1-26-23(31)21-18-12-17(14-5-6-14)19(13-28(35(32)33)11-3-2-4-20(29)30)27-24(18)34-22(21)15-7-9-16(25)10-8-15/h7-10,12,14H,2-6,11,13H2,1H3,(H,26,31)(H,29,30)(H,32,33)/p-1 |
| InChIKey | ICLJNGLXOLNTIX-UHFFFAOYSA-M |
| XLogP | 3.72 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|