C27H33N4O6S- — CID 66664044
6-[[3-(3-carboxypropylamino)propyl-sulfinatoamino]methyl]-5-cyclopropyl-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridine (PubChem CID 66664044) has the molecular formula C27H33N4O6S- and a molecular weight of 541.65 g/mol. Its IUPAC name is 6-[[3-(3-carboxypropylamino)propyl-sulfinatoamino]methyl]-5-cyclopropyl-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridine.
| Compound Name | 6-[[3-(3-carboxypropylamino)propyl-sulfinatoamino]methyl]-5-cyclopropyl-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 66664044 |
| Molecular Formula | C27H33N4O6S- |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 6-[[3-(3-carboxypropylamino)propyl-sulfinatoamino]methyl]-5-cyclopropyl-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridine |
| SMILES | CNC(=O)c1c(-c2ccc(C)cc2)oc2nc(CN(CCCNCCCC(=O)O)S(=O)[O-])c(C3CC3)cc12 |
| InChI | InChI=1S/C27H34N4O6S/c1-17-6-8-19(9-7-17)25-24(26(34)28-2)21-15-20(18-10-11-18)22(30-27(21)37-25)16-31(38(35)36)14-4-13-29-12-3-5-23(32)33/h6-9,15,18,29H,3-5,10-14,16H2,1-2H3,(H,28,34)(H,32,33)(H,35,36)/p-1 |
| InChIKey | KBHZGCCWMUPOPQ-UHFFFAOYSA-M |
| XLogP | 3.48 |
| TPSA | 147.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|