C27H34N3O4S- — CID 71065817
5-cyclopropyl-6-[[heptyl(sulfinato)amino]methyl]-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridine (PubChem CID 71065817) has the molecular formula C27H34N3O4S- and a molecular weight of 496.65 g/mol. Its IUPAC name is 5-cyclopropyl-6-[[heptyl(sulfinato)amino]methyl]-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridine.
| Compound Name | 5-cyclopropyl-6-[[heptyl(sulfinato)amino]methyl]-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 71065817 |
| Molecular Formula | C27H34N3O4S- |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 5-cyclopropyl-6-[[heptyl(sulfinato)amino]methyl]-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridine |
| SMILES | CCCCCCCN(Cc1nc2oc(-c3ccc(C)cc3)c(C(=O)NC)c2cc1C1CC1)S(=O)[O-] |
| InChI | InChI=1S/C27H35N3O4S/c1-4-5-6-7-8-15-30(35(32)33)17-23-21(19-13-14-19)16-22-24(26(31)28-3)25(34-27(22)29-23)20-11-9-18(2)10-12-20/h9-12,16,19H,4-8,13-15,17H2,1-3H3,(H,28,31)(H,32,33)/p-1 |
| InChIKey | PPCONFFTPFOZOJ-UHFFFAOYSA-M |
| XLogP | 5.61 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|