C23H27IN3O4S- — CID 71065839
2-(4-ethylphenyl)-5-iodo-3-(methylcarbamoyl)-6-[[pentyl(sulfinato)amino]methyl]furo[2,3-b]pyridine (PubChem CID 71065839) has the molecular formula C23H27IN3O4S- and a molecular weight of 568.46 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-5-iodo-3-(methylcarbamoyl)-6-[[pentyl(sulfinato)amino]methyl]furo[2,3-b]pyridine.
| Compound Name | 2-(4-ethylphenyl)-5-iodo-3-(methylcarbamoyl)-6-[[pentyl(sulfinato)amino]methyl]furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 71065839 |
| Molecular Formula | C23H27IN3O4S- |
| Molecular Weight | 568.46 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | 2-(4-ethylphenyl)-5-iodo-3-(methylcarbamoyl)-6-[[pentyl(sulfinato)amino]methyl]furo[2,3-b]pyridine |
| SMILES | CCCCCN(Cc1nc2oc(-c3ccc(CC)cc3)c(C(=O)NC)c2cc1I)S(=O)[O-] |
| InChI | InChI=1S/C23H28IN3O4S/c1-4-6-7-12-27(32(29)30)14-19-18(24)13-17-20(22(28)25-3)21(31-23(17)26-19)16-10-8-15(5-2)9-11-16/h8-11,13H,4-7,12,14H2,1-3H3,(H,25,28)(H,29,30)/p-1 |
| InChIKey | VMSLUTBUVNXMME-UHFFFAOYSA-M |
| XLogP | 4.81 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|