C26H35IN3O6PS — CID 123176740
6-[5-[ethyl(methyl)phosphoryl]oxypentyl-methylsulfonylamino]-2-(4-ethylphenyl)-5-iodo-N-methylfuro[2,3-b]pyridine-3-carboxamide (PubChem CID 123176740) has the molecular formula C26H35IN3O6PS and a molecular weight of 675.53 g/mol. Its IUPAC name is 6-[5-[ethyl(methyl)phosphoryl]oxypentyl-methylsulfonylamino]-2-(4-ethylphenyl)-5-iodo-N-methylfuro[2,3-b]pyridine-3-carboxamide.
| Compound Name | 6-[5-[ethyl(methyl)phosphoryl]oxypentyl-methylsulfonylamino]-2-(4-ethylphenyl)-5-iodo-N-methylfuro[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123176740 |
| Molecular Formula | C26H35IN3O6PS |
| Molecular Weight | 675.53 g/mol |
| Exact Mass | 675.10 |
| IUPAC Name | 6-[5-[ethyl(methyl)phosphoryl]oxypentyl-methylsulfonylamino]-2-(4-ethylphenyl)-5-iodo-N-methylfuro[2,3-b]pyridine-3-carboxamide |
| SMILES | CCc1ccc(-c2oc3nc(N(CCCCCOP(C)(=O)CC)S(C)(=O)=O)c(I)cc3c2C(=O)NC)cc1 |
| InChI | InChI=1S/C26H35IN3O6PS/c1-6-18-11-13-19(14-12-18)23-22(25(31)28-3)20-17-21(27)24(29-26(20)36-23)30(38(5,33)34)15-9-8-10-16-35-37(4,32)7-2/h11-14,17H,6-10,15-16H2,1-5H3,(H,28,31) |
| InChIKey | BHWXLWIIBLLMCU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|