C28H39IN3O5PS — CID 163426013
N-[5-[ethoxymethyl(methyl)phosphanyl]pentyl]-N-[2-(4-ethylphenyl)-5-iodo-3-[3-(methylamino)oxiran-2-yl]furo[2,3-b]pyridin-6-yl]methanesulfonamide (PubChem CID 163426013) has the molecular formula C28H39IN3O5PS and a molecular weight of 687.58 g/mol. Its IUPAC name is N-[5-[ethoxymethyl(methyl)phosphanyl]pentyl]-N-[2-(4-ethylphenyl)-5-iodo-3-[3-(methylamino)oxiran-2-yl]furo[2,3-b]pyridin-6-yl]methanesulfonamide.
| Compound Name | N-[5-[ethoxymethyl(methyl)phosphanyl]pentyl]-N-[2-(4-ethylphenyl)-5-iodo-3-[3-(methylamino)oxiran-2-yl]furo[2,3-b]pyridin-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 163426013 |
| Molecular Formula | C28H39IN3O5PS |
| Molecular Weight | 687.58 g/mol |
| Exact Mass | 687.14 |
| IUPAC Name | N-[5-[ethoxymethyl(methyl)phosphanyl]pentyl]-N-[2-(4-ethylphenyl)-5-iodo-3-[3-(methylamino)oxiran-2-yl]furo[2,3-b]pyridin-6-yl]methanesulfonamide |
| SMILES | CCOCP(C)CCCCCN(c1nc2oc(-c3ccc(CC)cc3)c(C3OC3NC)c2cc1I)S(C)(=O)=O |
| InChI | InChI=1S/C28H39IN3O5PS/c1-6-19-11-13-20(14-12-19)24-23(25-28(30-3)37-25)21-17-22(29)26(31-27(21)36-24)32(39(5,33)34)15-9-8-10-16-38(4)18-35-7-2/h11-14,17,25,28,30H,6-10,15-16,18H2,1-5H3 |
| InChIKey | AMOWDWGXABHICN-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.58 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|