C24H28BrN3O4S — CID 54575876
6-[4-bromobutyl(methylsulfonyl)amino]-5-cyclopropyl-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 54575876) has the molecular formula C24H28BrN3O4S and a molecular weight of 534.48 g/mol. Its IUPAC name is 6-[4-bromobutyl(methylsulfonyl)amino]-5-cyclopropyl-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 6-[4-bromobutyl(methylsulfonyl)amino]-5-cyclopropyl-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 54575876 |
| Molecular Formula | C24H28BrN3O4S |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | 6-[4-bromobutyl(methylsulfonyl)amino]-5-cyclopropyl-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(C)cc2)oc2nc(N(CCCCBr)S(C)(=O)=O)c(C3CC3)cc12 |
| InChI | InChI=1S/C24H28BrN3O4S/c1-15-6-8-17(9-7-15)21-20(23(29)26-2)19-14-18(16-10-11-16)22(27-24(19)32-21)28(33(3,30)31)13-5-4-12-25/h6-9,14,16H,4-5,10-13H2,1-3H3,(H,26,29) |
| InChIKey | YGKJNOVVXDBHBT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|