C25H30BrN3O4S — CID 66663498
6-(6-bromohexylsulfonylamino)-5-cyclopropyl-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 66663498) has the molecular formula C25H30BrN3O4S and a molecular weight of 548.50 g/mol. Its IUPAC name is 6-(6-bromohexylsulfonylamino)-5-cyclopropyl-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 6-(6-bromohexylsulfonylamino)-5-cyclopropyl-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66663498 |
| Molecular Formula | C25H30BrN3O4S |
| Molecular Weight | 548.50 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | 6-(6-bromohexylsulfonylamino)-5-cyclopropyl-N-methyl-2-(4-methylphenyl)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(C)cc2)oc2nc(NS(=O)(=O)CCCCCCBr)c(C3CC3)cc12 |
| InChI | InChI=1S/C25H30BrN3O4S/c1-16-7-9-18(10-8-16)22-21(24(30)27-2)20-15-19(17-11-12-17)23(28-25(20)33-22)29-34(31,32)14-6-4-3-5-13-26/h7-10,15,17H,3-6,11-14H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | SETAMGJLWXPGEC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|