C25H32FN3O6S2 — CID 66664255
5-ethyl-2-(4-fluorophenyl)-N-methyl-6-(5-propan-2-ylsulfonylpentylsulfonylamino)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 66664255) has the molecular formula C25H32FN3O6S2 and a molecular weight of 553.68 g/mol. Its IUPAC name is 5-ethyl-2-(4-fluorophenyl)-N-methyl-6-(5-propan-2-ylsulfonylpentylsulfonylamino)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 5-ethyl-2-(4-fluorophenyl)-N-methyl-6-(5-propan-2-ylsulfonylpentylsulfonylamino)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66664255 |
| Molecular Formula | C25H32FN3O6S2 |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | 5-ethyl-2-(4-fluorophenyl)-N-methyl-6-(5-propan-2-ylsulfonylpentylsulfonylamino)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CCc1cc2c(C(=O)NC)c(-c3ccc(F)cc3)oc2nc1NS(=O)(=O)CCCCCS(=O)(=O)C(C)C |
| InChI | InChI=1S/C25H32FN3O6S2/c1-5-17-15-20-21(24(30)27-4)22(18-9-11-19(26)12-10-18)35-25(20)28-23(17)29-37(33,34)14-8-6-7-13-36(31,32)16(2)3/h9-12,15-16H,5-8,13-14H2,1-4H3,(H,27,30)(H,28,29) |
| InChIKey | ZSYLFGWARKCPCH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|