C20H20FN3O5S — CID 87095835
6-(ethylsulfonylamino)-2-(4-fluorophenyl)-N-methyl-5-(oxiran-2-ylmethyl)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 87095835) has the molecular formula C20H20FN3O5S and a molecular weight of 433.46 g/mol. Its IUPAC name is 6-(ethylsulfonylamino)-2-(4-fluorophenyl)-N-methyl-5-(oxiran-2-ylmethyl)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 6-(ethylsulfonylamino)-2-(4-fluorophenyl)-N-methyl-5-(oxiran-2-ylmethyl)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87095835 |
| Molecular Formula | C20H20FN3O5S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 6-(ethylsulfonylamino)-2-(4-fluorophenyl)-N-methyl-5-(oxiran-2-ylmethyl)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CCS(=O)(=O)Nc1nc2oc(-c3ccc(F)cc3)c(C(=O)NC)c2cc1CC1CO1 |
| InChI | InChI=1S/C20H20FN3O5S/c1-3-30(26,27)24-18-12(8-14-10-28-14)9-15-16(19(25)22-2)17(29-20(15)23-18)11-4-6-13(21)7-5-11/h4-7,9,14H,3,8,10H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | KSZYAGKVPBQJAH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|