C27H24FN3O4S — CID 71140160
6-(4-cyanobutylsulfonylamino)-2-(4-fluorophenyl)-N-methyl-5-phenyl-1-benzofuran-3-carboxamide (PubChem CID 71140160) has the molecular formula C27H24FN3O4S and a molecular weight of 505.57 g/mol. Its IUPAC name is 6-(4-cyanobutylsulfonylamino)-2-(4-fluorophenyl)-N-methyl-5-phenyl-1-benzofuran-3-carboxamide.
| Compound Name | 6-(4-cyanobutylsulfonylamino)-2-(4-fluorophenyl)-N-methyl-5-phenyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 71140160 |
| Molecular Formula | C27H24FN3O4S |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 6-(4-cyanobutylsulfonylamino)-2-(4-fluorophenyl)-N-methyl-5-phenyl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(NS(=O)(=O)CCCCC#N)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C27H24FN3O4S/c1-30-27(32)25-22-16-21(18-8-4-2-5-9-18)23(31-36(33,34)15-7-3-6-14-29)17-24(22)35-26(25)19-10-12-20(28)13-11-19/h2,4-5,8-13,16-17,31H,3,6-7,15H2,1H3,(H,30,32) |
| InChIKey | CSIRBDUWFZBYSD-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|