C29H29FN2O4S — CID 71138955
2-(4-fluorophenyl)-N-methyl-6-(5-methylhex-4-enylsulfonylamino)-5-phenyl-1-benzofuran-3-carboxamide (PubChem CID 71138955) has the molecular formula C29H29FN2O4S and a molecular weight of 520.63 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-methyl-6-(5-methylhex-4-enylsulfonylamino)-5-phenyl-1-benzofuran-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-methyl-6-(5-methylhex-4-enylsulfonylamino)-5-phenyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 71138955 |
| Molecular Formula | C29H29FN2O4S |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 2-(4-fluorophenyl)-N-methyl-6-(5-methylhex-4-enylsulfonylamino)-5-phenyl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(NS(=O)(=O)CCCC=C(C)C)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C29H29FN2O4S/c1-19(2)9-7-8-16-37(34,35)32-25-18-26-24(17-23(25)20-10-5-4-6-11-20)27(29(33)31-3)28(36-26)21-12-14-22(30)15-13-21/h4-6,9-15,17-18,32H,7-8,16H2,1-3H3,(H,31,33) |
| InChIKey | MNJNKRNIVZMVFX-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|