C26H23FN2O4S — CID 53378508
2-(4-fluorophenyl)-N-methyl-6-[methylsulfonyl(prop-2-enyl)amino]-5-phenyl-1-benzofuran-3-carboxamide (PubChem CID 53378508) has the molecular formula C26H23FN2O4S and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-methyl-6-[methylsulfonyl(prop-2-enyl)amino]-5-phenyl-1-benzofuran-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-methyl-6-[methylsulfonyl(prop-2-enyl)amino]-5-phenyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 53378508 |
| Molecular Formula | C26H23FN2O4S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-(4-fluorophenyl)-N-methyl-6-[methylsulfonyl(prop-2-enyl)amino]-5-phenyl-1-benzofuran-3-carboxamide |
| SMILES | C=CCN(c1cc2oc(-c3ccc(F)cc3)c(C(=O)NC)c2cc1-c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C26H23FN2O4S/c1-4-14-29(34(3,31)32)22-16-23-21(15-20(22)17-8-6-5-7-9-17)24(26(30)28-2)25(33-23)18-10-12-19(27)13-11-18/h4-13,15-16H,1,14H2,2-3H3,(H,28,30) |
| InChIKey | UIUHUNHFZJYNFZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|