C32H30FN3O5S — CID 53377980
2-(4-fluorophenyl)-N-methoxy-6-[2-(N-methylanilino)ethyl-methylsulfonylamino]-5-phenyl-1-benzofuran-3-carboxamide (PubChem CID 53377980) has the molecular formula C32H30FN3O5S and a molecular weight of 587.67 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-methoxy-6-[2-(N-methylanilino)ethyl-methylsulfonylamino]-5-phenyl-1-benzofuran-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-methoxy-6-[2-(N-methylanilino)ethyl-methylsulfonylamino]-5-phenyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 53377980 |
| Molecular Formula | C32H30FN3O5S |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | 2-(4-fluorophenyl)-N-methoxy-6-[2-(N-methylanilino)ethyl-methylsulfonylamino]-5-phenyl-1-benzofuran-3-carboxamide |
| SMILES | CONC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(CCN(C)c3ccccc3)S(C)(=O)=O)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C32H30FN3O5S/c1-35(25-12-8-5-9-13-25)18-19-36(42(3,38)39)28-21-29-27(20-26(28)22-10-6-4-7-11-22)30(32(37)34-40-2)31(41-29)23-14-16-24(33)17-15-23/h4-17,20-21H,18-19H2,1-3H3,(H,34,37) |
| InChIKey | MOXLCJVOIJYOIP-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|