C29H31FN2O6S — CID 123483126
ethyl 4-[[2-(4-fluorophenyl)-3-[hydroxy(methylamino)methyl]-5-phenyl-1-benzofuran-6-yl]-methylsulfonylamino]butanoate (PubChem CID 123483126) has the molecular formula C29H31FN2O6S and a molecular weight of 554.64 g/mol. Its IUPAC name is ethyl 4-[[2-(4-fluorophenyl)-3-[hydroxy(methylamino)methyl]-5-phenyl-1-benzofuran-6-yl]-methylsulfonylamino]butanoate.
| Compound Name | ethyl 4-[[2-(4-fluorophenyl)-3-[hydroxy(methylamino)methyl]-5-phenyl-1-benzofuran-6-yl]-methylsulfonylamino]butanoate |
|---|---|
| PubChem CID | 123483126 |
| Molecular Formula | C29H31FN2O6S |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | ethyl 4-[[2-(4-fluorophenyl)-3-[hydroxy(methylamino)methyl]-5-phenyl-1-benzofuran-6-yl]-methylsulfonylamino]butanoate |
| SMILES | CCOC(=O)CCCN(c1cc2oc(-c3ccc(F)cc3)c(C(O)NC)c2cc1-c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C29H31FN2O6S/c1-4-37-26(33)11-8-16-32(39(3,35)36)24-18-25-23(17-22(24)19-9-6-5-7-10-19)27(29(34)31-2)28(38-25)20-12-14-21(30)15-13-20/h5-7,9-10,12-15,17-18,29,31,34H,4,8,11,16H2,1-3H3 |
| InChIKey | LKZUONWMBIRKSB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|