C24H26FNO5S — CID 88981494
ethyl 2-(4-fluorophenyl)-5-methyl-6-[methylsulfonyl(pent-4-enyl)amino]-1-benzofuran-3-carboxylate (PubChem CID 88981494) has the molecular formula C24H26FNO5S and a molecular weight of 459.54 g/mol. Its IUPAC name is ethyl 2-(4-fluorophenyl)-5-methyl-6-[methylsulfonyl(pent-4-enyl)amino]-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 2-(4-fluorophenyl)-5-methyl-6-[methylsulfonyl(pent-4-enyl)amino]-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 88981494 |
| Molecular Formula | C24H26FNO5S |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | ethyl 2-(4-fluorophenyl)-5-methyl-6-[methylsulfonyl(pent-4-enyl)amino]-1-benzofuran-3-carboxylate |
| SMILES | C=CCCCN(c1cc2oc(-c3ccc(F)cc3)c(C(=O)OCC)c2cc1C)S(C)(=O)=O |
| InChI | InChI=1S/C24H26FNO5S/c1-5-7-8-13-26(32(4,28)29)20-15-21-19(14-16(20)3)22(24(27)30-6-2)23(31-21)17-9-11-18(25)12-10-17/h5,9-12,14-15H,1,6-8,13H2,2-4H3 |
| InChIKey | PYUBPTJHBWPOTF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|