C24H25NO6S — CID 118241980
ethyl 5-acetyl-2-(4-methylphenyl)-6-[methylsulfonyl(prop-2-enyl)amino]-1-benzofuran-3-carboxylate (PubChem CID 118241980) has the molecular formula C24H25NO6S and a molecular weight of 455.53 g/mol. Its IUPAC name is ethyl 5-acetyl-2-(4-methylphenyl)-6-[methylsulfonyl(prop-2-enyl)amino]-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 5-acetyl-2-(4-methylphenyl)-6-[methylsulfonyl(prop-2-enyl)amino]-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 118241980 |
| Molecular Formula | C24H25NO6S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | ethyl 5-acetyl-2-(4-methylphenyl)-6-[methylsulfonyl(prop-2-enyl)amino]-1-benzofuran-3-carboxylate |
| SMILES | C=CCN(c1cc2oc(-c3ccc(C)cc3)c(C(=O)OCC)c2cc1C(C)=O)S(C)(=O)=O |
| InChI | InChI=1S/C24H25NO6S/c1-6-12-25(32(5,28)29)20-14-21-19(13-18(20)16(4)26)22(24(27)30-7-2)23(31-21)17-10-8-15(3)9-11-17/h6,8-11,13-14H,1,7,12H2,2-5H3 |
| InChIKey | UAJLEWOCSKEVPK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|