C22H22FNO6S — CID 88981485
ethyl 6-[but-3-enyl(methylsulfonyl)amino]-2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate (PubChem CID 88981485) has the molecular formula C22H22FNO6S and a molecular weight of 447.48 g/mol. Its IUPAC name is ethyl 6-[but-3-enyl(methylsulfonyl)amino]-2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 6-[but-3-enyl(methylsulfonyl)amino]-2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 88981485 |
| Molecular Formula | C22H22FNO6S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | ethyl 6-[but-3-enyl(methylsulfonyl)amino]-2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate |
| SMILES | C=CCCN(c1cc2oc(-c3ccc(F)cc3)c(C(=O)OCC)c2cc1O)S(C)(=O)=O |
| InChI | InChI=1S/C22H22FNO6S/c1-4-6-11-24(31(3,27)28)17-13-19-16(12-18(17)25)20(22(26)29-5-2)21(30-19)14-7-9-15(23)10-8-14/h4,7-10,12-13,25H,1,5-6,11H2,2-3H3 |
| InChIKey | MFWSFJTYEFWEQW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|