C34H24F2N2O12 — CID 161153046
ethyl 2-(4-fluorophenyl)-5-hydroxy-4-nitro-1-benzofuran-3-carboxylate;ethyl 2-(4-fluorophenyl)-5-hydroxy-6-nitro-1-benzofuran-3-carboxylate (PubChem CID 161153046) has the molecular formula C34H24F2N2O12 and a molecular weight of 690.56 g/mol. Its IUPAC name is ethyl 2-(4-fluorophenyl)-5-hydroxy-4-nitro-1-benzofuran-3-carboxylate;ethyl 2-(4-fluorophenyl)-5-hydroxy-6-nitro-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 2-(4-fluorophenyl)-5-hydroxy-4-nitro-1-benzofuran-3-carboxylate;ethyl 2-(4-fluorophenyl)-5-hydroxy-6-nitro-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 161153046 |
| Molecular Formula | C34H24F2N2O12 |
| Molecular Weight | 690.56 g/mol |
| Exact Mass | 690.13 |
| IUPAC Name | ethyl 2-(4-fluorophenyl)-5-hydroxy-4-nitro-1-benzofuran-3-carboxylate;ethyl 2-(4-fluorophenyl)-5-hydroxy-6-nitro-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)oc2cc([N+](=O)[O-])c(O)cc12.CCOC(=O)c1c(-c2ccc(F)cc2)oc2ccc(O)c([N+](=O)[O-])c12 |
| InChI | InChI=1S/2C17H12FNO6/c1-2-24-17(21)15-11-7-13(20)12(19(22)23)8-14(11)25-16(15)9-3-5-10(18)6-4-9;1-2-24-17(21)14-13-12(8-7-11(20)15(13)19(22)23)25-16(14)9-3-5-10(18)6-4-9/h2*3-8,20H,2H2,1H3 |
| InChIKey | UOXYSUYQMDPWCC-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 205.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.56 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|