C18H14FNO7S — CID 58472776
[2-(4-fluorophenyl)-6-nitro-3-propanoyl-1-benzofuran-5-yl] methanesulfonate (PubChem CID 58472776) has the molecular formula C18H14FNO7S and a molecular weight of 407.38 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-6-nitro-3-propanoyl-1-benzofuran-5-yl] methanesulfonate.
| Compound Name | [2-(4-fluorophenyl)-6-nitro-3-propanoyl-1-benzofuran-5-yl] methanesulfonate |
|---|---|
| PubChem CID | 58472776 |
| Molecular Formula | C18H14FNO7S |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | [2-(4-fluorophenyl)-6-nitro-3-propanoyl-1-benzofuran-5-yl] methanesulfonate |
| SMILES | CCC(=O)c1c(-c2ccc(F)cc2)oc2cc([N+](=O)[O-])c(OS(C)(=O)=O)cc12 |
| InChI | InChI=1S/C18H14FNO7S/c1-3-14(21)17-12-8-16(27-28(2,24)25)13(20(22)23)9-15(12)26-18(17)10-4-6-11(19)7-5-10/h4-9H,3H2,1-2H3 |
| InChIKey | IOQBMZUTMKXISK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 116.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|