C23H16FNO7 — CID 67354947
ethyl 2-[4-(4-fluorophenoxy)phenyl]-5-hydroxy-6-nitro-1-benzofuran-3-carboxylate (PubChem CID 67354947) has the molecular formula C23H16FNO7 and a molecular weight of 437.38 g/mol. Its IUPAC name is ethyl 2-[4-(4-fluorophenoxy)phenyl]-5-hydroxy-6-nitro-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 2-[4-(4-fluorophenoxy)phenyl]-5-hydroxy-6-nitro-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 67354947 |
| Molecular Formula | C23H16FNO7 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | ethyl 2-[4-(4-fluorophenoxy)phenyl]-5-hydroxy-6-nitro-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Oc3ccc(F)cc3)cc2)oc2cc([N+](=O)[O-])c(O)cc12 |
| InChI | InChI=1S/C23H16FNO7/c1-2-30-23(27)21-17-11-19(26)18(25(28)29)12-20(17)32-22(21)13-3-7-15(8-4-13)31-16-9-5-14(24)6-10-16/h3-12,26H,2H2,1H3 |
| InChIKey | ZIJCZCXYVRUAIM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 112.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|