C24H16FNO6 — CID 58472548
3-[2-(4-fluorophenyl)-6-nitro-3-propanoyl-1-benzofuran-5-yl]benzoic acid (PubChem CID 58472548) has the molecular formula C24H16FNO6 and a molecular weight of 433.39 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)-6-nitro-3-propanoyl-1-benzofuran-5-yl]benzoic acid.
| Compound Name | 3-[2-(4-fluorophenyl)-6-nitro-3-propanoyl-1-benzofuran-5-yl]benzoic acid |
|---|---|
| PubChem CID | 58472548 |
| Molecular Formula | C24H16FNO6 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 3-[2-(4-fluorophenyl)-6-nitro-3-propanoyl-1-benzofuran-5-yl]benzoic acid |
| SMILES | CCC(=O)c1c(-c2ccc(F)cc2)oc2cc([N+](=O)[O-])c(-c3cccc(C(=O)O)c3)cc12 |
| InChI | InChI=1S/C24H16FNO6/c1-2-20(27)22-18-11-17(14-4-3-5-15(10-14)24(28)29)19(26(30)31)12-21(18)32-23(22)13-6-8-16(25)9-7-13/h3-12H,2H2,1H3,(H,28,29) |
| InChIKey | GDKMSVGBQSLQAN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|