C32H26FN3O5 — CID 59275466
2-(4-fluorophenyl)-N-methyl-4-nitro-5-[3-(2-phenylpropan-2-ylcarbamoyl)phenyl]-1-benzofuran-3-carboxamide (PubChem CID 59275466) has the molecular formula C32H26FN3O5 and a molecular weight of 551.57 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-methyl-4-nitro-5-[3-(2-phenylpropan-2-ylcarbamoyl)phenyl]-1-benzofuran-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-methyl-4-nitro-5-[3-(2-phenylpropan-2-ylcarbamoyl)phenyl]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 59275466 |
| Molecular Formula | C32H26FN3O5 |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | 2-(4-fluorophenyl)-N-methyl-4-nitro-5-[3-(2-phenylpropan-2-ylcarbamoyl)phenyl]-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2ccc(-c3cccc(C(=O)NC(C)(C)c4ccccc4)c3)c([N+](=O)[O-])c12 |
| InChI | InChI=1S/C32H26FN3O5/c1-32(2,22-10-5-4-6-11-22)35-30(37)21-9-7-8-20(18-21)24-16-17-25-26(28(24)36(39)40)27(31(38)34-3)29(41-25)19-12-14-23(33)15-13-19/h4-18H,1-3H3,(H,34,38)(H,35,37) |
| InChIKey | GJZCKNOVHWSJQB-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|