C27H27FN3O7+ — CID 145142073
[5-[3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamoyl]phenyl]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-hydroxyazanium (PubChem CID 145142073) has the molecular formula C27H27FN3O7+ and a molecular weight of 524.53 g/mol. Its IUPAC name is [5-[3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamoyl]phenyl]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-hydroxyazanium.
| Compound Name | [5-[3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamoyl]phenyl]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-hydroxyazanium |
|---|---|
| PubChem CID | 145142073 |
| Molecular Formula | C27H27FN3O7+ |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | [5-[3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamoyl]phenyl]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-hydroxyazanium |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc([NH2+]O)c(-c3cccc(C(=O)NC(CO)(CO)CO)c3)cc12 |
| InChI | InChI=1S/C27H26FN3O7/c1-29-26(36)23-20-10-19(16-3-2-4-17(9-16)25(35)30-27(12-32,13-33)14-34)21(31-37)11-22(20)38-24(23)15-5-7-18(28)8-6-15/h2-11,31-34,37H,12-14H2,1H3,(H,29,36)(H,30,35)/p+1 |
| InChIKey | OXFLFTLNZJDATA-UHFFFAOYSA-O |
| XLogP | 1.30 |
| TPSA | 168.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|