C28H21F2N3O5 — CID 85470189
5-[3-(1-bicyclo[1.1.1]pentanylcarbamoyl)phenyl]-4-fluoro-2-(4-fluorophenyl)-N-methyl-6-nitro-1-benzofuran-3-carboxamide (PubChem CID 85470189) has the molecular formula C28H21F2N3O5 and a molecular weight of 517.49 g/mol. Its IUPAC name is 5-[3-(1-bicyclo[1.1.1]pentanylcarbamoyl)phenyl]-4-fluoro-2-(4-fluorophenyl)-N-methyl-6-nitro-1-benzofuran-3-carboxamide.
| Compound Name | 5-[3-(1-bicyclo[1.1.1]pentanylcarbamoyl)phenyl]-4-fluoro-2-(4-fluorophenyl)-N-methyl-6-nitro-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 85470189 |
| Molecular Formula | C28H21F2N3O5 |
| Molecular Weight | 517.49 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 5-[3-(1-bicyclo[1.1.1]pentanylcarbamoyl)phenyl]-4-fluoro-2-(4-fluorophenyl)-N-methyl-6-nitro-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc([N+](=O)[O-])c(-c3cccc(C(=O)NC45CC(C4)C5)c3)c(F)c12 |
| InChI | InChI=1S/C28H21F2N3O5/c1-31-27(35)23-22-20(38-25(23)15-5-7-18(29)8-6-15)10-19(33(36)37)21(24(22)30)16-3-2-4-17(9-16)26(34)32-28-11-14(12-28)13-28/h2-10,14H,11-13H2,1H3,(H,31,35)(H,32,34) |
| InChIKey | UHHZEDPPANMHCC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|