C29H21FN2O3 — CID 58472569
1-[2-(4-fluorophenyl)-5-[3-(2-pyrazin-2-ylacetyl)phenyl]-1-benzofuran-3-yl]propan-1-one (PubChem CID 58472569) has the molecular formula C29H21FN2O3 and a molecular weight of 464.50 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-5-[3-(2-pyrazin-2-ylacetyl)phenyl]-1-benzofuran-3-yl]propan-1-one.
| Compound Name | 1-[2-(4-fluorophenyl)-5-[3-(2-pyrazin-2-ylacetyl)phenyl]-1-benzofuran-3-yl]propan-1-one |
|---|---|
| PubChem CID | 58472569 |
| Molecular Formula | C29H21FN2O3 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-5-[3-(2-pyrazin-2-ylacetyl)phenyl]-1-benzofuran-3-yl]propan-1-one |
| SMILES | CCC(=O)c1c(-c2ccc(F)cc2)oc2ccc(-c3cccc(C(=O)Cc4cnccn4)c3)cc12 |
| InChI | InChI=1S/C29H21FN2O3/c1-2-25(33)28-24-15-20(8-11-27(24)35-29(28)18-6-9-22(30)10-7-18)19-4-3-5-21(14-19)26(34)16-23-17-31-12-13-32-23/h3-15,17H,2,16H2,1H3 |
| InChIKey | UINRCMLVYVLUCQ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |