C37H38FN3O5S — CID 147671567
3-[6-(diethylamino)-2-(4-fluorophenyl)-3-propanoyl-1-benzofuran-5-yl]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]benzamide (PubChem CID 147671567) has the molecular formula C37H38FN3O5S and a molecular weight of 655.79 g/mol. Its IUPAC name is 3-[6-(diethylamino)-2-(4-fluorophenyl)-3-propanoyl-1-benzofuran-5-yl]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]benzamide.
| Compound Name | 3-[6-(diethylamino)-2-(4-fluorophenyl)-3-propanoyl-1-benzofuran-5-yl]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 147671567 |
| Molecular Formula | C37H38FN3O5S |
| Molecular Weight | 655.79 g/mol |
| Exact Mass | 655.25 |
| IUPAC Name | 3-[6-(diethylamino)-2-(4-fluorophenyl)-3-propanoyl-1-benzofuran-5-yl]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]benzamide |
| SMILES | CCC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(CC)CC)c(-c3cccc(C(=O)NCCNS(=O)(=O)c4ccc(C)cc4)c3)cc12 |
| InChI | InChI=1S/C37H38FN3O5S/c1-5-33(42)35-31-22-30(32(41(6-2)7-3)23-34(31)46-36(35)25-13-15-28(38)16-14-25)26-9-8-10-27(21-26)37(43)39-19-20-40-47(44,45)29-17-11-24(4)12-18-29/h8-18,21-23,40H,5-7,19-20H2,1-4H3,(H,39,43) |
| InChIKey | GNINPVGWMDRHDJ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.79 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|