C35H38N4O3 — CID 157455206
3-[6-(diethylamino)-2-(4-methylphenyl)-3-propanoyl-1-benzofuran-5-yl]-N-(3-imidazol-1-ylpropyl)benzamide (PubChem CID 157455206) has the molecular formula C35H38N4O3 and a molecular weight of 562.71 g/mol. Its IUPAC name is 3-[6-(diethylamino)-2-(4-methylphenyl)-3-propanoyl-1-benzofuran-5-yl]-N-(3-imidazol-1-ylpropyl)benzamide.
| Compound Name | 3-[6-(diethylamino)-2-(4-methylphenyl)-3-propanoyl-1-benzofuran-5-yl]-N-(3-imidazol-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 157455206 |
| Molecular Formula | C35H38N4O3 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | 3-[6-(diethylamino)-2-(4-methylphenyl)-3-propanoyl-1-benzofuran-5-yl]-N-(3-imidazol-1-ylpropyl)benzamide |
| SMILES | CCC(=O)c1c(-c2ccc(C)cc2)oc2cc(N(CC)CC)c(-c3cccc(C(=O)NCCCn4ccnc4)c3)cc12 |
| InChI | InChI=1S/C35H38N4O3/c1-5-31(40)33-29-21-28(26-10-8-11-27(20-26)35(41)37-16-9-18-38-19-17-36-23-38)30(39(6-2)7-3)22-32(29)42-34(33)25-14-12-24(4)13-15-25/h8,10-15,17,19-23H,5-7,9,16,18H2,1-4H3,(H,37,41) |
| InChIKey | QUTSTKPRIWZOCH-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|