C34H35FN4O3 — CID 149091994
3-[6-(diethylamino)-2-(4-fluorophenyl)-3-propanoyl-1-benzofuran-5-yl]-N-(3-imidazol-1-ylpropyl)benzamide (PubChem CID 149091994) has the molecular formula C34H35FN4O3 and a molecular weight of 566.68 g/mol. Its IUPAC name is 3-[6-(diethylamino)-2-(4-fluorophenyl)-3-propanoyl-1-benzofuran-5-yl]-N-(3-imidazol-1-ylpropyl)benzamide.
| Compound Name | 3-[6-(diethylamino)-2-(4-fluorophenyl)-3-propanoyl-1-benzofuran-5-yl]-N-(3-imidazol-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 149091994 |
| Molecular Formula | C34H35FN4O3 |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 3-[6-(diethylamino)-2-(4-fluorophenyl)-3-propanoyl-1-benzofuran-5-yl]-N-(3-imidazol-1-ylpropyl)benzamide |
| SMILES | CCC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(CC)CC)c(-c3cccc(C(=O)NCCCn4ccnc4)c3)cc12 |
| InChI | InChI=1S/C34H35FN4O3/c1-4-30(40)32-28-20-27(24-9-7-10-25(19-24)34(41)37-15-8-17-38-18-16-36-22-38)29(39(5-2)6-3)21-31(28)42-33(32)23-11-13-26(35)14-12-23/h7,9-14,16,18-22H,4-6,8,15,17H2,1-3H3,(H,37,41) |
| InChIKey | QSOMHYRYXCIOBR-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|