C25H21FN2O6S — CID 160863065
N-[2-(4-fluorophenyl)-5-(3-nitrophenyl)-3-propanoyl-1-benzofuran-6-yl]-N-methylmethanesulfonamide (PubChem CID 160863065) has the molecular formula C25H21FN2O6S and a molecular weight of 496.52 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-5-(3-nitrophenyl)-3-propanoyl-1-benzofuran-6-yl]-N-methylmethanesulfonamide.
| Compound Name | N-[2-(4-fluorophenyl)-5-(3-nitrophenyl)-3-propanoyl-1-benzofuran-6-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 160863065 |
| Molecular Formula | C25H21FN2O6S |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | N-[2-(4-fluorophenyl)-5-(3-nitrophenyl)-3-propanoyl-1-benzofuran-6-yl]-N-methylmethanesulfonamide |
| SMILES | CCC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)S(C)(=O)=O)c(-c3cccc([N+](=O)[O-])c3)cc12 |
| InChI | InChI=1S/C25H21FN2O6S/c1-4-22(29)24-20-13-19(16-6-5-7-18(12-16)28(30)31)21(27(2)35(3,32)33)14-23(20)34-25(24)15-8-10-17(26)11-9-15/h5-14H,4H2,1-3H3 |
| InChIKey | LHWRDRUIEUDIHX-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 110.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|