C39H41FN2O5SSi — CID 157371645
N-[2-(4-fluorophenyl)-3-propanoyl-5-[3-[1-(2-trimethylsilylethoxymethyl)indol-2-yl]phenyl]-1-benzofuran-6-yl]-N-methylmethanesulfonamide (PubChem CID 157371645) has the molecular formula C39H41FN2O5SSi and a molecular weight of 696.92 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-3-propanoyl-5-[3-[1-(2-trimethylsilylethoxymethyl)indol-2-yl]phenyl]-1-benzofuran-6-yl]-N-methylmethanesulfonamide.
| Compound Name | N-[2-(4-fluorophenyl)-3-propanoyl-5-[3-[1-(2-trimethylsilylethoxymethyl)indol-2-yl]phenyl]-1-benzofuran-6-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 157371645 |
| Molecular Formula | C39H41FN2O5SSi |
| Molecular Weight | 696.92 g/mol |
| Exact Mass | 696.25 |
| IUPAC Name | N-[2-(4-fluorophenyl)-3-propanoyl-5-[3-[1-(2-trimethylsilylethoxymethyl)indol-2-yl]phenyl]-1-benzofuran-6-yl]-N-methylmethanesulfonamide |
| SMILES | CCC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)S(C)(=O)=O)c(-c3cccc(-c4cc5ccccc5n4COCC[Si](C)(C)C)c3)cc12 |
| InChI | InChI=1S/C39H41FN2O5SSi/c1-7-36(43)38-32-23-31(35(41(2)48(3,44)45)24-37(32)47-39(38)26-15-17-30(40)18-16-26)27-12-10-13-28(21-27)34-22-29-11-8-9-14-33(29)42(34)25-46-19-20-49(4,5)6/h8-18,21-24H,7,19-20,25H2,1-6H3 |
| InChIKey | QAMJPKQENWPHNX-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.92 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|