C22H23FN2O8S — CID 90686380
carbamoyl 2-(4-fluorophenyl)-6-[2-hydroxyethyl(methylsulfonyl)amino]-5-propan-2-yloxy-1-benzofuran-3-carboxylate (PubChem CID 90686380) has the molecular formula C22H23FN2O8S and a molecular weight of 494.50 g/mol. Its IUPAC name is carbamoyl 2-(4-fluorophenyl)-6-[2-hydroxyethyl(methylsulfonyl)amino]-5-propan-2-yloxy-1-benzofuran-3-carboxylate.
| Compound Name | carbamoyl 2-(4-fluorophenyl)-6-[2-hydroxyethyl(methylsulfonyl)amino]-5-propan-2-yloxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 90686380 |
| Molecular Formula | C22H23FN2O8S |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | carbamoyl 2-(4-fluorophenyl)-6-[2-hydroxyethyl(methylsulfonyl)amino]-5-propan-2-yloxy-1-benzofuran-3-carboxylate |
| SMILES | CC(C)Oc1cc2c(C(=O)OC(N)=O)c(-c3ccc(F)cc3)oc2cc1N(CCO)S(C)(=O)=O |
| InChI | InChI=1S/C22H23FN2O8S/c1-12(2)31-18-10-15-17(11-16(18)25(8-9-26)34(3,29)30)32-20(13-4-6-14(23)7-5-13)19(15)21(27)33-22(24)28/h4-7,10-12,26H,8-9H2,1-3H3,(H2,24,28) |
| InChIKey | KPSISRWOIXONBE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 149.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|