C21H20FNO6 — CID 90803350
carbamoyl 2-(4-fluorophenyl)-6-(1-hydroxyethyl)-5-propan-2-yloxy-1-benzofuran-3-carboxylate (PubChem CID 90803350) has the molecular formula C21H20FNO6 and a molecular weight of 401.39 g/mol. Its IUPAC name is carbamoyl 2-(4-fluorophenyl)-6-(1-hydroxyethyl)-5-propan-2-yloxy-1-benzofuran-3-carboxylate.
| Compound Name | carbamoyl 2-(4-fluorophenyl)-6-(1-hydroxyethyl)-5-propan-2-yloxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 90803350 |
| Molecular Formula | C21H20FNO6 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | carbamoyl 2-(4-fluorophenyl)-6-(1-hydroxyethyl)-5-propan-2-yloxy-1-benzofuran-3-carboxylate |
| SMILES | CC(C)Oc1cc2c(C(=O)OC(N)=O)c(-c3ccc(F)cc3)oc2cc1C(C)O |
| InChI | InChI=1S/C21H20FNO6/c1-10(2)27-16-9-15-17(8-14(16)11(3)24)28-19(12-4-6-13(22)7-5-12)18(15)20(25)29-21(23)26/h4-11,24H,1-3H3,(H2,23,26) |
| InChIKey | LQAMPJHPPBOYII-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|